C28H25F4N5O5 — CID 122503271
N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-methoxy-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide (PubChem CID 122503271) has the molecular formula C28H25F4N5O5 and a molecular weight of 587.53 g/mol. Its IUPAC name is N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-methoxy-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-methoxy-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 122503271 |
| Molecular Formula | C28H25F4N5O5 |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | N-[2-[3-amino-7-(4-fluorophenyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoro-2-hydroxypropyl]-3-methoxy-4-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
| SMILES | COc1cc(C(=O)NCC(O)(c2cc3c(c(-c4ccc(F)cc4)n2)OCC3(C)N)C(F)(F)F)ccc1-c1nc(C)no1 |
| InChI | InChI=1S/C28H25F4N5O5/c1-14-35-25(42-37-14)18-9-6-16(10-20(18)40-3)24(38)34-12-27(39,28(30,31)32)21-11-19-23(41-13-26(19,2)33)22(36-21)15-4-7-17(29)8-5-15/h4-11,39H,12-13,33H2,1-3H3,(H,34,38) |
| InChIKey | ACSPAXIZCMGUOL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |