C12H20FN — CID 122503523
1-(6-fluoro-1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)-N-methylmethanamine (PubChem CID 122503523) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is 1-(6-fluoro-1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(6-fluoro-1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 122503523 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 1-(6-fluoro-1,2,3,4,4a,5,8,8a-octahydronaphthalen-2-yl)-N-methylmethanamine |
| SMILES | CNCC1CCC2CC(F)=CCC2C1 |
| InChI | InChI=1S/C12H20FN/c1-14-8-9-2-3-11-7-12(13)5-4-10(11)6-9/h5,9-11,14H,2-4,6-8H2,1H3 |
| InChIKey | IJKNYSCFWINUHP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |