C27H24F2N2O4 — CID 122503575
methyl 3-[2-(4-fluorophenyl)-6-(3-fluoropropylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoate (PubChem CID 122503575) has the molecular formula C27H24F2N2O4 and a molecular weight of 478.50 g/mol. Its IUPAC name is methyl 3-[2-(4-fluorophenyl)-6-(3-fluoropropylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoate.
| Compound Name | methyl 3-[2-(4-fluorophenyl)-6-(3-fluoropropylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoate |
|---|---|
| PubChem CID | 122503575 |
| Molecular Formula | C27H24F2N2O4 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methyl 3-[2-(4-fluorophenyl)-6-(3-fluoropropylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NCCCF)c(-c3cccc(C(=O)OC)c3)cc12 |
| InChI | InChI=1S/C27H24F2N2O4/c1-30-26(32)24-21-14-20(17-5-3-6-18(13-17)27(33)34-2)22(31-12-4-11-28)15-23(21)35-25(24)16-7-9-19(29)10-8-16/h3,5-10,13-15,31H,4,11-12H2,1-2H3,(H,30,32) |
| InChIKey | IVWALRGLEMZSCJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|