C23H36O2 — CID 122503893
(5S)-4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 122503893) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (5S)-4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | (5S)-4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 122503893 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (5S)-4-methoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1C=CC(=O)C(C)[C@@H]1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H36O2/c1-17(2)9-7-10-18(3)11-8-12-19(4)13-14-21-20(5)22(24)15-16-23(21)25-6/h9,11,13,15-16,20-21,23H,7-8,10,12,14H2,1-6H3/b18-11+,19-13+/t20?,21-,23?/m0/s1 |
| InChIKey | BEPPOOQZKGWRBO-LNISTFLESA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|