About 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene
2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene (PubChem CID 122503947) has the molecular formula C15H15F3O3S
and a molecular weight of 332.34 g/mol. Its IUPAC name is 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene.
Molecular Properties
| Compound Name | 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene |
| PubChem CID | 122503947 |
| Molecular Formula | C15H15F3O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene |
| SMILES | COc1ccc2cc(C(CS(C)(=O)=O)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C15H15F3O3S/c1-21-13-6-5-10-7-12(4-3-11(10)8-13)14(15(16,17)18)9-22(2,19)20/h3-8,14H,9H2,1-2H3 |
| InChIKey | OIJZQGMQTXFOCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene?
The IUPAC name of 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene (CID 122503947) is 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene.
What is the SMILES notation for 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene?
The canonical SMILES for 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene is COc1ccc2cc(C(CS(C)(=O)=O)C(F)(F)F)ccc2c1.
What is the InChIKey of 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene?
The InChIKey is OIJZQGMQTXFOCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3O3S/c1-21-13-6-5-10-7-12(4-3-11(10)8-13)14(15(16,17)18)9-22(2,19)20/h3-8,14H,9H2,1-2H3.
What are the key properties of 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene?
2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene has a molecular weight of 332.34 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-(1,1,1-trifluoro-3-methylsulfonylpropan-2-yl)naphthalene is sourced from PubChem (CID 122503947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).