C18H22O7 — CID 122504233
(1S,12R,13R,14S,15S)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione (PubChem CID 122504233) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is (1S,12R,13R,14S,15S)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione.
| Compound Name | (1S,12R,13R,14S,15S)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione |
|---|---|
| PubChem CID | 122504233 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (1S,12R,13R,14S,15S)-6-ethyl-13,14,15-trihydroxy-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione |
| SMILES | CCc1oc(=O)cc2c1CC1OC(=O)[C@]3(C)C1[C@]2(C)[C@H](O)[C@H](O)[C@@H]3O |
| InChI | InChI=1S/C18H22O7/c1-4-9-7-5-10-13-17(2,8(7)6-11(19)24-9)14(21)12(20)15(22)18(13,3)16(23)25-10/h6,10,12-15,20-22H,4-5H2,1-3H3/t10?,12-,13?,14+,15-,17+,18+/m0/s1 |
| InChIKey | BBNIEZUCHOPINF-MPGHZKPWSA-N |
| XLogP | -0.34 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |