About 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid
2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid (PubChem CID 122506037) has the molecular formula C10H10N4O4
and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid |
| PubChem CID | 122506037 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid |
| SMILES | C=CCn1c(=O)[nH]c(=O)c2[nH]c(CC(=O)O)nc21 |
| InChI | InChI=1S/C10H10N4O4/c1-2-3-14-8-7(9(17)13-10(14)18)11-5(12-8)4-6(15)16/h2H,1,3-4H2,(H,11,12)(H,15,16)(H,13,17,18) |
| InChIKey | UAYMOXHAGPORGZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid?
The IUPAC name of 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid (CID 122506037) is 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid.
What is the SMILES notation for 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid?
The canonical SMILES for 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid is C=CCn1c(=O)[nH]c(=O)c2[nH]c(CC(=O)O)nc21.
What is the InChIKey of 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid?
The InChIKey is UAYMOXHAGPORGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O4/c1-2-3-14-8-7(9(17)13-10(14)18)11-5(12-8)4-6(15)16/h2H,1,3-4H2,(H,11,12)(H,15,16)(H,13,17,18).
What are the key properties of 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid?
2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid has a molecular weight of 250.21 g/mol, XLogP of -0.77, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dioxo-3-prop-2-enyl-7H-purin-8-yl)acetic acid is sourced from PubChem (CID 122506037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).