C17H9F3N4O3S — CID 122506254
[[(1R)-7-[(5-cyano-3-pyridinyl)oxy]-1,2,2-trifluoro-3-oxo-1H-inden-4-yl]-methyl-oxo-λ6-sulfanylidene]cyanamide (PubChem CID 122506254) has the molecular formula C17H9F3N4O3S and a molecular weight of 406.35 g/mol. Its IUPAC name is [[(1R)-7-[(5-cyano-3-pyridinyl)oxy]-1,2,2-trifluoro-3-oxo-1H-inden-4-yl]-methyl-oxo-λ6-sulfanylidene]cyanamide.
| Compound Name | [[(1R)-7-[(5-cyano-3-pyridinyl)oxy]-1,2,2-trifluoro-3-oxo-1H-inden-4-yl]-methyl-oxo-λ6-sulfanylidene]cyanamide |
|---|---|
| PubChem CID | 122506254 |
| Molecular Formula | C17H9F3N4O3S |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [[(1R)-7-[(5-cyano-3-pyridinyl)oxy]-1,2,2-trifluoro-3-oxo-1H-inden-4-yl]-methyl-oxo-λ6-sulfanylidene]cyanamide |
| SMILES | CS(=O)(=NC#N)c1ccc(Oc2cncc(C#N)c2)c2c1C(=O)C(F)(F)[C@@H]2F |
| InChI | InChI=1S/C17H9F3N4O3S/c1-28(26,24-8-22)12-3-2-11(27-10-4-9(5-21)6-23-7-10)13-14(12)16(25)17(19,20)15(13)18/h2-4,6-7,15H,1H3/t15-,28?/m1/s1 |
| InChIKey | LWXVEXAXAMEALA-AATNMNKESA-N |
| XLogP | 3.53 |
| TPSA | 116.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|