About (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol
(1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 122506257) has the molecular formula C11H13FO4S
and a molecular weight of 260.29 g/mol. Its IUPAC name is (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 122506257 |
| Molecular Formula | C11H13FO4S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | CS(=O)(=O)c1ccc(F)c2c1[C@H](O)C[C@@H]2CO |
| InChI | InChI=1S/C11H13FO4S/c1-17(15,16)9-3-2-7(12)10-6(5-13)4-8(14)11(9)10/h2-3,6,8,13-14H,4-5H2,1H3/t6-,8-/m1/s1 |
| InChIKey | YEQIEZCPDKYBAA-HTRCEHHLSA-N |
| XLogP | 0.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol (CID 122506257) is (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol is CS(=O)(=O)c1ccc(F)c2c1[C@H](O)C[C@@H]2CO.
What is the InChIKey of (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is YEQIEZCPDKYBAA-HTRCEHHLSA-N. The full InChI is InChI=1S/C11H13FO4S/c1-17(15,16)9-3-2-7(12)10-6(5-13)4-8(14)11(9)10/h2-3,6,8,13-14H,4-5H2,1H3/t6-,8-/m1/s1.
What are the key properties of (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol?
(1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 260.29 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-4-fluoro-3-(hydroxymethyl)-7-methylsulfonyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 122506257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).