C18H27Cl3O2 — CID 122506454
[(7E)-4,8,12-trimethyltrideca-3,7,11-trienyl] 2,2,2-trichloroacetate (PubChem CID 122506454) has the molecular formula C18H27Cl3O2 and a molecular weight of 381.77 g/mol. Its IUPAC name is [(7E)-4,8,12-trimethyltrideca-3,7,11-trienyl] 2,2,2-trichloroacetate.
| Compound Name | [(7E)-4,8,12-trimethyltrideca-3,7,11-trienyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 122506454 |
| Molecular Formula | C18H27Cl3O2 |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [(7E)-4,8,12-trimethyltrideca-3,7,11-trienyl] 2,2,2-trichloroacetate |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)=CCCOC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H27Cl3O2/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-23-17(22)18(19,20)21/h8,10,12H,5-7,9,11,13H2,1-4H3/b15-10+,16-12? |
| InChIKey | NGEAWAIMPGJWAV-AJXWQLJOSA-N |
| XLogP | 6.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|