C28H21F2N5O3 — CID 122507180
(2R)-2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dimethyl-1,4-benzoxazin-3-one (PubChem CID 122507180) has the molecular formula C28H21F2N5O3 and a molecular weight of 513.50 g/mol. Its IUPAC name is (2R)-2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | (2R)-2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 122507180 |
| Molecular Formula | C28H21F2N5O3 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | (2R)-2-[4-[[2-(2,6-difluorophenyl)-5-oxo-6,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl]amino]phenyl]-2,4-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)[C@@](C)(c2ccc(Nc3nc(-c4c(F)cccc4F)nc4c3C(=O)NC4)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C28H21F2N5O3/c1-28(27(37)35(2)20-8-3-4-9-21(20)38-28)15-10-12-16(13-11-15)32-25-23-19(14-31-26(23)36)33-24(34-25)22-17(29)6-5-7-18(22)30/h3-13H,14H2,1-2H3,(H,31,36)(H,32,33,34)/t28-/m1/s1 |
| InChIKey | WWONFIUFKFQGKQ-MUUNZHRXSA-N |
| XLogP | 4.68 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |