C9H13N3O2 — CID 122507445
2-oxo-1-propan-2-ylpyridine-4-carbohydrazide (PubChem CID 122507445) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-oxo-1-propan-2-ylpyridine-4-carbohydrazide.
| Compound Name | 2-oxo-1-propan-2-ylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 122507445 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-oxo-1-propan-2-ylpyridine-4-carbohydrazide |
| SMILES | CC(C)n1ccc(C(=O)NN)cc1=O |
| InChI | InChI=1S/C9H13N3O2/c1-6(2)12-4-3-7(5-8(12)13)9(14)11-10/h3-6H,10H2,1-2H3,(H,11,14) |
| InChIKey | AQTHAEQESPPLNN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|