About 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine
6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine (PubChem CID 122508037) has the molecular formula C8H8ClN3O
and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine |
| PubChem CID | 122508037 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine |
| SMILES | Nc1nnc(Cl)cc1C1=CCCO1 |
| InChI | InChI=1S/C8H8ClN3O/c9-7-4-5(8(10)12-11-7)6-2-1-3-13-6/h2,4H,1,3H2,(H2,10,12) |
| InChIKey | DPCBKPZJWHJCGB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine?
The IUPAC name of 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine (CID 122508037) is 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine.
What is the SMILES notation for 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine?
The canonical SMILES for 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine is Nc1nnc(Cl)cc1C1=CCCO1.
What is the InChIKey of 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine?
The InChIKey is DPCBKPZJWHJCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O/c9-7-4-5(8(10)12-11-7)6-2-1-3-13-6/h2,4H,1,3H2,(H2,10,12).
What are the key properties of 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine?
6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine has a molecular weight of 197.62 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(2,3-dihydrofuran-5-yl)pyridazin-3-amine is sourced from PubChem (CID 122508037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).