C14H18N2O4 — CID 122508290
3-(diethoxymethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 122508290) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(diethoxymethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(diethoxymethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 122508290 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-(diethoxymethyl)-5-(4-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1noc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C14H18N2O4/c1-4-18-14(19-5-2)12-15-13(20-16-12)10-6-8-11(17-3)9-7-10/h6-9,14H,4-5H2,1-3H3 |
| InChIKey | WHLSFJDMNVWWDK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|