C25H22F3N3O6S — CID 122510071
N-(1,3-benzodioxol-5-yl)-N-methyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-(2,4,5-trifluorophenyl)propanamide (PubChem CID 122510071) has the molecular formula C25H22F3N3O6S and a molecular weight of 549.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-methyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-(2,4,5-trifluorophenyl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-methyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-(2,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 122510071 |
| Molecular Formula | C25H22F3N3O6S |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-methyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-(2,4,5-trifluorophenyl)propanamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)NC(Cc1cc(F)c(F)cc1F)C(=O)N(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H22F3N3O6S/c1-14-5-3-4-6-23(14)38(34,35)30-25(33)29-20(10-15-9-18(27)19(28)12-17(15)26)24(32)31(2)16-7-8-21-22(11-16)37-13-36-21/h3-9,11-12,20H,10,13H2,1-2H3,(H2,29,30,33) |
| InChIKey | FVFVATHLNZYJND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|