C29H39N5O4 — CID 122510254
2-amino-8-N-[3-[2-(2-aminoethoxy)ethoxymethyl]phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide (PubChem CID 122510254) has the molecular formula C29H39N5O4 and a molecular weight of 521.66 g/mol. Its IUPAC name is 2-amino-8-N-[3-[2-(2-aminoethoxy)ethoxymethyl]phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide.
| Compound Name | 2-amino-8-N-[3-[2-(2-aminoethoxy)ethoxymethyl]phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 122510254 |
| Molecular Formula | C29H39N5O4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-amino-8-N-[3-[2-(2-aminoethoxy)ethoxymethyl]phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(C(=O)Nc3cccc(COCCOCCN)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C29H39N5O4/c1-3-11-34(12-4-2)29(36)24-17-22-8-9-23(18-26(22)33-27(31)19-24)28(35)32-25-7-5-6-21(16-25)20-38-15-14-37-13-10-30/h5-9,16-18H,3-4,10-15,19-20,30H2,1-2H3,(H2,31,33)(H,32,35) |
| InChIKey | BFNYMTDJMJIUQM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|