C29H39N5O2 — CID 122510263
2-amino-8-N-[3-(5-aminopentyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide (PubChem CID 122510263) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-amino-8-N-[3-(5-aminopentyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide.
| Compound Name | 2-amino-8-N-[3-(5-aminopentyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 122510263 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 2-amino-8-N-[3-(5-aminopentyl)phenyl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(C(=O)Nc3cccc(CCCCCN)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C29H39N5O2/c1-3-15-34(16-4-2)29(36)24-18-22-12-13-23(19-26(22)33-27(31)20-24)28(35)32-25-11-8-10-21(17-25)9-6-5-7-14-30/h8,10-13,17-19H,3-7,9,14-16,20,30H2,1-2H3,(H2,31,33)(H,32,35) |
| InChIKey | ZFMWMFLPLXVIHL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|