C19H15F3N6O2 — CID 122510655
6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-N-methoxyimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 122510655) has the molecular formula C19H15F3N6O2 and a molecular weight of 416.36 g/mol. Its IUPAC name is 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-N-methoxyimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-N-methoxyimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 122510655 |
| Molecular Formula | C19H15F3N6O2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-N-methoxyimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CONC(=O)c1cnc2ccc(-c3c(-c4ccc(F)cc4)ncn3CC(F)F)nn12 |
| InChI | InChI=1S/C19H15F3N6O2/c1-30-26-19(29)14-8-23-16-7-6-13(25-28(14)16)18-17(11-2-4-12(20)5-3-11)24-10-27(18)9-15(21)22/h2-8,10,15H,9H2,1H3,(H,26,29) |
| InChIKey | RWDMPAOHRFJLAV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|