About 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine
6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine (PubChem CID 122510719) has the molecular formula C18H12F4N4
and a molecular weight of 360.31 g/mol. Its IUPAC name is 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine |
| PubChem CID | 122510719 |
| Molecular Formula | C18H12F4N4 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1ccc(-c2ncn(CC(F)F)c2-c2ccc3ncc(F)n3c2)cc1 |
| InChI | InChI=1S/C18H12F4N4/c19-13-4-1-11(2-5-13)17-18(25(10-24-17)9-14(20)21)12-3-6-16-23-7-15(22)26(16)8-12/h1-8,10,14H,9H2 |
| InChIKey | QBRYOGARJOUITH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine?
The IUPAC name of 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine (CID 122510719) is 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine?
The canonical SMILES for 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine is Fc1ccc(-c2ncn(CC(F)F)c2-c2ccc3ncc(F)n3c2)cc1.
What is the InChIKey of 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine?
The InChIKey is QBRYOGARJOUITH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F4N4/c19-13-4-1-11(2-5-13)17-18(25(10-24-17)9-14(20)21)12-3-6-16-23-7-15(22)26(16)8-12/h1-8,10,14H,9H2.
What are the key properties of 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine?
6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine has a molecular weight of 360.31 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-fluoroimidazo[1,2-a]pyridine is sourced from PubChem (CID 122510719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).