About 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole
6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole (PubChem CID 122510894) has the molecular formula C16H10F2N4
and a molecular weight of 296.28 g/mol. Its IUPAC name is 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole.
Molecular Properties
| Compound Name | 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole |
| PubChem CID | 122510894 |
| Molecular Formula | C16H10F2N4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole |
| SMILES | Fc1ccc(-c2nc[nH]c2-c2ccc3cn[nH]c3c2)cc1F |
| InChI | InChI=1S/C16H10F2N4/c17-12-4-3-9(5-13(12)18)15-16(20-8-19-15)10-1-2-11-7-21-22-14(11)6-10/h1-8H,(H,19,20)(H,21,22) |
| InChIKey | BZVUIERTZMSASW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole?
The IUPAC name of 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole (CID 122510894) is 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole.
What is the SMILES notation for 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole?
The canonical SMILES for 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole is Fc1ccc(-c2nc[nH]c2-c2ccc3cn[nH]c3c2)cc1F.
What is the InChIKey of 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole?
The InChIKey is BZVUIERTZMSASW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F2N4/c17-12-4-3-9(5-13(12)18)15-16(20-8-19-15)10-1-2-11-7-21-22-14(11)6-10/h1-8H,(H,19,20)(H,21,22).
What are the key properties of 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole?
6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole has a molecular weight of 296.28 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(3,4-difluorophenyl)-1H-imidazol-5-yl]-1H-indazole is sourced from PubChem (CID 122510894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).