C26H28F6N4O4S — CID 122510982
N-cyclopropylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[1-(6,6,6-trifluorohexyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 122510982) has the molecular formula C26H28F6N4O4S and a molecular weight of 606.59 g/mol. Its IUPAC name is N-cyclopropylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[1-(6,6,6-trifluorohexyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | N-cyclopropylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[1-(6,6,6-trifluorohexyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 122510982 |
| Molecular Formula | C26H28F6N4O4S |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | N-cyclopropylsulfonyl-4-(4-methylphenyl)-6-oxo-2-[1-(6,6,6-trifluorohexyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)NS(=O)(=O)C3CC3)C(=O)NC(c3cnn(CCCCCC(F)(F)F)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C26H28F6N4O4S/c1-16-5-7-17(8-6-16)20-13-24(26(30,31)32,18-14-33-36(15-18)12-4-2-3-11-25(27,28)29)34-22(37)21(20)23(38)35-41(39,40)19-9-10-19/h5-8,14-15,19H,2-4,9-13H2,1H3,(H,34,37)(H,35,38) |
| InChIKey | VUOWUCAKXYBWLC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|