About (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide
(E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide (PubChem CID 122511676) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide.
Molecular Properties
| Compound Name | (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide |
| PubChem CID | 122511676 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide |
| SMILES | CNC(=O)/C=C/C(C)(C)NCCOC |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,12-7-8-14-4)6-5-9(13)11-3/h5-6,12H,7-8H2,1-4H3,(H,11,13)/b6-5+ |
| InChIKey | NWXDQSCUCNLMBU-AATRIKPKSA-N |
| XLogP | 0.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide?
The IUPAC name of (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide (CID 122511676) is (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide.
What is the SMILES notation for (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide?
The canonical SMILES for (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide is CNC(=O)/C=C/C(C)(C)NCCOC.
What is the InChIKey of (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide?
The InChIKey is NWXDQSCUCNLMBU-AATRIKPKSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-10(2,12-7-8-14-4)6-5-9(13)11-3/h5-6,12H,7-8H2,1-4H3,(H,11,13)/b6-5+.
What are the key properties of (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide?
(E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide has a molecular weight of 200.28 g/mol, XLogP of 0.30, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2-methoxyethylamino)-N,4-dimethylpent-2-enamide is sourced from PubChem (CID 122511676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).