C22H27NO5S — CID 122512697
(2R)-2-[benzylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methoxy-3-phenylpropanoic acid (PubChem CID 122512697) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is (2R)-2-[benzylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methoxy-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[benzylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methoxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122512697 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (2R)-2-[benzylsulfanyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methoxy-3-phenylpropanoic acid |
| SMILES | COC(c1ccccc1)[C@H](C(=O)O)N(SCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27NO5S/c1-22(2,3)28-21(26)23(29-15-16-11-7-5-8-12-16)18(20(24)25)19(27-4)17-13-9-6-10-14-17/h5-14,18-19H,15H2,1-4H3,(H,24,25)/t18-,19?/m1/s1 |
| InChIKey | KAYBGRGFXBSJAP-MRTLOADZSA-N |
| XLogP | 4.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|