C33H35F2N5O6 — CID 122512730
N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-propoxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide (PubChem CID 122512730) has the molecular formula C33H35F2N5O6 and a molecular weight of 635.67 g/mol. Its IUPAC name is N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-propoxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide.
| Compound Name | N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-propoxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 122512730 |
| Molecular Formula | C33H35F2N5O6 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | N-[(3R,4R)-4-[[4-[2,3-difluoro-6-[2-(2-propoxyethoxy)ethoxy]benzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide |
| SMILES | CCCOCCOCCOc1ccc(F)c(F)c1C(=O)c1ccc(C(=O)N[C@@H]2CNC[C@H]2NC(=O)c2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C33H35F2N5O6/c1-2-11-44-12-13-45-14-15-46-28-10-9-24(34)30(35)29(28)31(41)20-3-5-21(6-4-20)32(42)38-26-18-36-19-27(26)39-33(43)22-7-8-23-17-37-40-25(23)16-22/h3-10,16-17,26-27,36H,2,11-15,18-19H2,1H3,(H,37,40)(H,38,42)(H,39,43)/t26-,27-/m1/s1 |
| InChIKey | INUXIUMZCKKVSD-KAYWLYCHSA-N |
| XLogP | 3.39 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|