C31H32FN5O7 — CID 122512759
N-[(3R,4R)-4-[[4-[2-fluoro-6-[2-(2-hydroxyethoxy)ethoxy]-3-methoxybenzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide (PubChem CID 122512759) has the molecular formula C31H32FN5O7 and a molecular weight of 605.62 g/mol. Its IUPAC name is N-[(3R,4R)-4-[[4-[2-fluoro-6-[2-(2-hydroxyethoxy)ethoxy]-3-methoxybenzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide.
| Compound Name | N-[(3R,4R)-4-[[4-[2-fluoro-6-[2-(2-hydroxyethoxy)ethoxy]-3-methoxybenzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 122512759 |
| Molecular Formula | C31H32FN5O7 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | N-[(3R,4R)-4-[[4-[2-fluoro-6-[2-(2-hydroxyethoxy)ethoxy]-3-methoxybenzoyl]benzoyl]amino]pyrrolidin-3-yl]-1H-indazole-6-carboxamide |
| SMILES | COc1ccc(OCCOCCO)c(C(=O)c2ccc(C(=O)N[C@@H]3CNC[C@H]3NC(=O)c3ccc4cn[nH]c4c3)cc2)c1F |
| InChI | InChI=1S/C31H32FN5O7/c1-42-26-9-8-25(44-13-12-43-11-10-38)27(28(26)32)29(39)18-2-4-19(5-3-18)30(40)35-23-16-33-17-24(23)36-31(41)20-6-7-21-15-34-37-22(21)14-20/h2-9,14-15,23-24,33,38H,10-13,16-17H2,1H3,(H,34,37)(H,35,40)(H,36,41)/t23-,24-/m1/s1 |
| InChIKey | LXUVAMCWUAUHBD-DNQXCXABSA-N |
| XLogP | 1.83 |
| TPSA | 163.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|