C5H10ClNO2S — CID 122513295
(2S,4S)-4-aminothiolane-2-carboxylic acid;hydrochloride (PubChem CID 122513295) has the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. Its IUPAC name is (2S,4S)-4-aminothiolane-2-carboxylic acid;hydrochloride.
| Compound Name | (2S,4S)-4-aminothiolane-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 122513295 |
| Molecular Formula | C5H10ClNO2S |
| Molecular Weight | 183.66 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | (2S,4S)-4-aminothiolane-2-carboxylic acid;hydrochloride |
| SMILES | Cl.N[C@@H]1CS[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C5H9NO2S.ClH/c6-3-1-4(5(7)8)9-2-3;/h3-4H,1-2,6H2,(H,7,8);1H/t3-,4-;/m0./s1 |
| InChIKey | UBOSBWVRFTXFNO-MMALYQPHSA-N |
| XLogP | 0.33 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.66 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |