C12H17F3N2O4 — CID 122513389
2,2-dimethyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 122513389) has the molecular formula C12H17F3N2O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 2,2-dimethyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122513389 |
| Molecular Formula | C12H17F3N2O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2,2-dimethyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H](NC(=O)C(=O)N1CCC(C(=O)O)C1(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O4/c1-6(12(13,14)15)16-8(18)9(19)17-5-4-7(10(20)21)11(17,2)3/h6-7H,4-5H2,1-3H3,(H,16,18)(H,20,21)/t6-,7?/m1/s1 |
| InChIKey | YFYYHWSNMITQSQ-ULUSZKPHSA-N |
| XLogP | 0.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|