C15H18N2O3 — CID 122513477
(3aS,6aS)-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 122513477) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3aS,6aS)-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aS,6aS)-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 122513477 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3aS,6aS)-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydro-2H-pyrrolo[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | C[C@H](c1ccccc1)N1CC[C@H]2CN(C(=O)O)C(=O)[C@H]21 |
| InChI | InChI=1S/C15H18N2O3/c1-10(11-5-3-2-4-6-11)16-8-7-12-9-17(15(19)20)14(18)13(12)16/h2-6,10,12-13H,7-9H2,1H3,(H,19,20)/t10-,12+,13+/m1/s1 |
| InChIKey | VTFDOKVHPUBZFV-WXHSDQCUSA-N |
| XLogP | 1.96 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |