C19H24F3N3O4 — CID 122514518
(3S,4S)-1-(2-ethoxyethyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 122514518) has the molecular formula C19H24F3N3O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is (3S,4S)-1-(2-ethoxyethyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-1-(2-ethoxyethyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122514518 |
| Molecular Formula | C19H24F3N3O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (3S,4S)-1-(2-ethoxyethyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CCOCCN1C[C@@H](C(F)(F)F)[C@H](C(=O)Nc2ccccc2/C=C/C(=O)NO)C1 |
| InChI | InChI=1S/C19H24F3N3O4/c1-2-29-10-9-25-11-14(15(12-25)19(20,21)22)18(27)23-16-6-4-3-5-13(16)7-8-17(26)24-28/h3-8,14-15,28H,2,9-12H2,1H3,(H,23,27)(H,24,26)/b8-7+/t14-,15-/m1/s1 |
| InChIKey | ULLDUGKLVUCPAD-FHFZEBMASA-N |
| XLogP | 2.29 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|