C32H36ClN7O3 — CID 122514604
tert-butyl N-benzyl-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]-4-(prop-2-enoylamino)cyclohexyl]carbamate (PubChem CID 122514604) has the molecular formula C32H36ClN7O3 and a molecular weight of 602.14 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]-4-(prop-2-enoylamino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]-4-(prop-2-enoylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 122514604 |
| Molecular Formula | C32H36ClN7O3 |
| Molecular Weight | 602.14 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | tert-butyl N-benzyl-N-[(1S,3R)-3-[[5-chloro-4-(1H-indazol-3-yl)pyrimidin-2-yl]amino]-4-(prop-2-enoylamino)cyclohexyl]carbamate |
| SMILES | C=CC(=O)NC1CC[C@H](N(Cc2ccccc2)C(=O)OC(C)(C)C)C[C@H]1Nc1ncc(Cl)c(-c2n[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C32H36ClN7O3/c1-5-27(41)35-25-16-15-21(40(31(42)43-32(2,3)4)19-20-11-7-6-8-12-20)17-26(25)36-30-34-18-23(33)29(37-30)28-22-13-9-10-14-24(22)38-39-28/h5-14,18,21,25-26H,1,15-17,19H2,2-4H3,(H,35,41)(H,38,39)(H,34,36,37)/t21-,25?,26+/m0/s1 |
| InChIKey | HQFJEDVITSTEOU-PYOKFVPOSA-N |
| XLogP | 6.11 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.14 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|