C26H27ClF3N5O5S2 — CID 122514612
cis-(1R,3S)-1-N-[4-[1-(benzenesulfonyl)-2-methylindol-3-yl]-5-chloropyrimidin-2-yl]cyclohexane-1,3-diamine;trifluoromethanesulfonic acid (PubChem CID 122514612) has the molecular formula C26H27ClF3N5O5S2 and a molecular weight of 646.11 g/mol. Its IUPAC name is cis-(1R,3S)-1-N-[4-[1-(benzenesulfonyl)-2-methylindol-3-yl]-5-chloropyrimidin-2-yl]cyclohexane-1,3-diamine;trifluoromethanesulfonic acid.
| Compound Name | cis-(1R,3S)-1-N-[4-[1-(benzenesulfonyl)-2-methylindol-3-yl]-5-chloropyrimidin-2-yl]cyclohexane-1,3-diamine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 122514612 |
| Molecular Formula | C26H27ClF3N5O5S2 |
| Molecular Weight | 646.11 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | cis-(1R,3S)-1-N-[4-[1-(benzenesulfonyl)-2-methylindol-3-yl]-5-chloropyrimidin-2-yl]cyclohexane-1,3-diamine;trifluoromethanesulfonic acid |
| SMILES | Cc1c(-c2nc(N[C@@H]3CCC[C@H](N)C3)ncc2Cl)c2ccccc2n1S(=O)(=O)c1ccccc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C25H26ClN5O2S.CHF3O3S/c1-16-23(24-21(26)15-28-25(30-24)29-18-9-7-8-17(27)14-18)20-12-5-6-13-22(20)31(16)34(32,33)19-10-3-2-4-11-19;2-1(3,4)8(5,6)7/h2-6,10-13,15,17-18H,7-9,14,27H2,1H3,(H,28,29,30);(H,5,6,7)/t17-,18+;/m0./s1 |
| InChIKey | BZELDSPVSBSRAD-CJRXIRLBSA-N |
| XLogP | 5.37 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.11 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|