C22H32O9 — CID 122514728
(3R)-3-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]hexanedioic acid (PubChem CID 122514728) has the molecular formula C22H32O9 and a molecular weight of 440.49 g/mol. Its IUPAC name is (3R)-3-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]hexanedioic acid.
| Compound Name | (3R)-3-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]hexanedioic acid |
|---|---|
| PubChem CID | 122514728 |
| Molecular Formula | C22H32O9 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (3R)-3-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-6-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]hexanedioic acid |
| SMILES | C=CC[C@@H]1O[C@@H]([C@H](CCC(=O)O)CC(=O)O)[C@H]2OC3(CCCCC3)O[C@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H32O9/c1-3-7-15-19(28-13(2)23)21-20(30-22(31-21)10-5-4-6-11-22)18(29-15)14(12-17(26)27)8-9-16(24)25/h3,14-15,18-21H,1,4-12H2,2H3,(H,24,25)(H,26,27)/t14-,15+,18+,19+,20-,21+/m1/s1 |
| InChIKey | YNXIXFDYVGITJD-OCDKWSBESA-N |
| XLogP | 2.66 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|