About 7,8-dimethylpurine-2,6-diamine
7,8-dimethylpurine-2,6-diamine (PubChem CID 122515075) has the molecular formula C7H10N6
and a molecular weight of 178.20 g/mol. Its IUPAC name is 7,8-dimethylpurine-2,6-diamine.
Molecular Properties
| Compound Name | 7,8-dimethylpurine-2,6-diamine |
| PubChem CID | 122515075 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 7,8-dimethylpurine-2,6-diamine |
| SMILES | Cc1nc2nc(N)nc(N)c2n1C |
| InChI | InChI=1S/C7H10N6/c1-3-10-6-4(13(3)2)5(8)11-7(9)12-6/h1-2H3,(H4,8,9,11,12) |
| InChIKey | UHWCUMBAWRSLLE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7,8-dimethylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethylpurine-2,6-diamine?
The IUPAC name of 7,8-dimethylpurine-2,6-diamine (CID 122515075) is 7,8-dimethylpurine-2,6-diamine.
What is the SMILES notation for 7,8-dimethylpurine-2,6-diamine?
The canonical SMILES for 7,8-dimethylpurine-2,6-diamine is Cc1nc2nc(N)nc(N)c2n1C.
What is the InChIKey of 7,8-dimethylpurine-2,6-diamine?
The InChIKey is UHWCUMBAWRSLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6/c1-3-10-6-4(13(3)2)5(8)11-7(9)12-6/h1-2H3,(H4,8,9,11,12).
What are the key properties of 7,8-dimethylpurine-2,6-diamine?
7,8-dimethylpurine-2,6-diamine has a molecular weight of 178.20 g/mol, XLogP of -0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethylpurine-2,6-diamine is sourced from PubChem (CID 122515075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).