About 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene
4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene (PubChem CID 122515511) has the molecular formula C10H6BrF5O2S
and a molecular weight of 365.12 g/mol. Its IUPAC name is 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene.
Molecular Properties
| Compound Name | 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene |
| PubChem CID | 122515511 |
| Molecular Formula | C10H6BrF5O2S |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene |
| SMILES | O=S(=O)(c1ccc(Br)c2c1CC(F)(F)C2)C(F)(F)F |
| InChI | InChI=1S/C10H6BrF5O2S/c11-7-1-2-8(19(17,18)10(14,15)16)6-4-9(12,13)3-5(6)7/h1-2H,3-4H2 |
| InChIKey | SVXHZWAZZMBADQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene?
The IUPAC name of 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene (CID 122515511) is 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene.
What is the SMILES notation for 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene?
The canonical SMILES for 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene is O=S(=O)(c1ccc(Br)c2c1CC(F)(F)C2)C(F)(F)F.
What is the InChIKey of 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene?
The InChIKey is SVXHZWAZZMBADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF5O2S/c11-7-1-2-8(19(17,18)10(14,15)16)6-4-9(12,13)3-5(6)7/h1-2H,3-4H2.
What are the key properties of 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene?
4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene has a molecular weight of 365.12 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,2-difluoro-7-(trifluoromethylsulfonyl)-1,3-dihydroindene is sourced from PubChem (CID 122515511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).