C14H12F4O4 — CID 122515514
7'-(2,2-difluoroethoxy)-2',2'-difluorospiro[1,3-dioxolane-2,3'-1H-indene]-4'-carbaldehyde (PubChem CID 122515514) has the molecular formula C14H12F4O4 and a molecular weight of 320.24 g/mol. Its IUPAC name is 7'-(2,2-difluoroethoxy)-2',2'-difluorospiro[1,3-dioxolane-2,3'-1H-indene]-4'-carbaldehyde.
| Compound Name | 7'-(2,2-difluoroethoxy)-2',2'-difluorospiro[1,3-dioxolane-2,3'-1H-indene]-4'-carbaldehyde |
|---|---|
| PubChem CID | 122515514 |
| Molecular Formula | C14H12F4O4 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 7'-(2,2-difluoroethoxy)-2',2'-difluorospiro[1,3-dioxolane-2,3'-1H-indene]-4'-carbaldehyde |
| SMILES | O=Cc1ccc(OCC(F)F)c2c1C1(OCCO1)C(F)(F)C2 |
| InChI | InChI=1S/C14H12F4O4/c15-11(16)7-20-10-2-1-8(6-19)12-9(10)5-13(17,18)14(12)21-3-4-22-14/h1-2,6,11H,3-5,7H2 |
| InChIKey | SCJKDDMPHURDMS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|