About (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid
(4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid (PubChem CID 122515579) has the molecular formula C4H7FNO6P
and a molecular weight of 215.07 g/mol. Its IUPAC name is (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid.
Molecular Properties
| Compound Name | (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid |
| PubChem CID | 122515579 |
| Molecular Formula | C4H7FNO6P |
| Molecular Weight | 215.07 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid |
| SMILES | O=C1C(F)C(O)C(P(=O)(O)O)N1O |
| InChI | InChI=1S/C4H7FNO6P/c5-1-2(7)4(13(10,11)12)6(9)3(1)8/h1-2,4,7,9H,(H2,10,11,12) |
| InChIKey | UBCAVWHLWBNRTA-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.07 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid?
The IUPAC name of (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid (CID 122515579) is (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid.
What is the SMILES notation for (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid?
The canonical SMILES for (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid is O=C1C(F)C(O)C(P(=O)(O)O)N1O.
What is the InChIKey of (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid?
The InChIKey is UBCAVWHLWBNRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7FNO6P/c5-1-2(7)4(13(10,11)12)6(9)3(1)8/h1-2,4,7,9H,(H2,10,11,12).
What are the key properties of (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid?
(4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid has a molecular weight of 215.07 g/mol, XLogP of -1.58, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-1,3-dihydroxy-5-oxopyrrolidin-2-yl)phosphonic acid is sourced from PubChem (CID 122515579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).