C17H11F4N5O — CID 122516055
3-(4-fluoroanilino)-N-[6-(trifluoromethyl)-3-pyridinyl]pyrazine-2-carboxamide (PubChem CID 122516055) has the molecular formula C17H11F4N5O and a molecular weight of 377.30 g/mol. Its IUPAC name is 3-(4-fluoroanilino)-N-[6-(trifluoromethyl)-3-pyridinyl]pyrazine-2-carboxamide.
| Compound Name | 3-(4-fluoroanilino)-N-[6-(trifluoromethyl)-3-pyridinyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 122516055 |
| Molecular Formula | C17H11F4N5O |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-(4-fluoroanilino)-N-[6-(trifluoromethyl)-3-pyridinyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)nc1)c1nccnc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H11F4N5O/c18-10-1-3-11(4-2-10)25-15-14(22-7-8-23-15)16(27)26-12-5-6-13(24-9-12)17(19,20)21/h1-9H,(H,23,25)(H,26,27) |
| InChIKey | PHMKJRAGYVKCEF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |