About [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine
[2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine (PubChem CID 122516171) has the molecular formula C21H17FN4OS
and a molecular weight of 392.46 g/mol. Its IUPAC name is [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine |
| PubChem CID | 122516171 |
| Molecular Formula | C21H17FN4OS |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(Oc2cccc3c2CCN3c2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C21H17FN4OS/c22-14-4-5-16-19(11-14)28-21(25-16)26-9-7-15-17(26)2-1-3-18(15)27-20-10-13(12-23)6-8-24-20/h1-6,8,10-11H,7,9,12,23H2 |
| InChIKey | IOWVFWHDGIWANZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine?
The IUPAC name of [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine (CID 122516171) is [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine.
What is the SMILES notation for [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine?
The canonical SMILES for [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine is NCc1ccnc(Oc2cccc3c2CCN3c2nc3ccc(F)cc3s2)c1.
What is the InChIKey of [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine?
The InChIKey is IOWVFWHDGIWANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN4OS/c22-14-4-5-16-19(11-14)28-21(25-16)26-9-7-15-17(26)2-1-3-18(15)27-20-10-13(12-23)6-8-24-20/h1-6,8,10-11H,7,9,12,23H2.
What are the key properties of [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine?
[2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine has a molecular weight of 392.46 g/mol, XLogP of 4.78, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[1-(6-fluoro-1,3-benzothiazol-2-yl)-2,3-dihydroindol-4-yl]oxy]-4-pyridinyl]methanamine is sourced from PubChem (CID 122516171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).