About [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine
[2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine (PubChem CID 122516337) has the molecular formula C21H15FN4OS
and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine |
| PubChem CID | 122516337 |
| Molecular Formula | C21H15FN4OS |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(Oc2cccc3c2ccn3-c2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C21H15FN4OS/c22-14-4-5-16-19(11-14)28-21(25-16)26-9-7-15-17(26)2-1-3-18(15)27-20-10-13(12-23)6-8-24-20/h1-11H,12,23H2 |
| InChIKey | YGNIIMKOTGQNME-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine?
The IUPAC name of [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine (CID 122516337) is [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine.
What is the SMILES notation for [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine?
The canonical SMILES for [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine is NCc1ccnc(Oc2cccc3c2ccn3-c2nc3ccc(F)cc3s2)c1.
What is the InChIKey of [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine?
The InChIKey is YGNIIMKOTGQNME-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FN4OS/c22-14-4-5-16-19(11-14)28-21(25-16)26-9-7-15-17(26)2-1-3-18(15)27-20-10-13(12-23)6-8-24-20/h1-11H,12,23H2.
What are the key properties of [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine?
[2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine has a molecular weight of 390.44 g/mol, XLogP of 5.03, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(6-fluoro-1,3-benzothiazol-2-yl)indol-4-yl]oxy-4-pyridinyl]methanamine is sourced from PubChem (CID 122516337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).