C7H6F5N3O2 — CID 122516559
[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamic acid (PubChem CID 122516559) has the molecular formula C7H6F5N3O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is [1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamic acid.
| Compound Name | [1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 122516559 |
| Molecular Formula | C7H6F5N3O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]carbamic acid |
| SMILES | Cn1cc(NC(=O)O)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H6F5N3O2/c1-15-2-3(13-5(16)17)4(14-15)6(8,9)7(10,11)12/h2,13H,1H3,(H,16,17) |
| InChIKey | HFAWSGVPRXPCOZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|