C6H6F5N3 — CID 122516589
1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-amine (PubChem CID 122516589) has the molecular formula C6H6F5N3 and a molecular weight of 215.12 g/mol. Its IUPAC name is 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-amine.
| Compound Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 122516589 |
| Molecular Formula | C6H6F5N3 |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-amine |
| SMILES | Cn1cc(N)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C6H6F5N3/c1-14-2-3(12)4(13-14)5(7,8)6(9,10)11/h2H,12H2,1H3 |
| InChIKey | XUYDUEYNVIIJDH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|