About N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol (PubChem CID 122517146) has the molecular formula C11H15Cl2N3O
and a molecular weight of 276.17 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol |
| PubChem CID | 122517146 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol |
| SMILES | CCO.Clc1cccc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C9H9Cl2N3.C2H6O/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9;1-2-3/h1-3H,4-5H2,(H2,12,13,14);3H,2H2,1H3 |
| InChIKey | FMKPELCPHMBZEO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol?
The IUPAC name of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol (CID 122517146) is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol.
What is the SMILES notation for N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol?
The canonical SMILES for N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol is CCO.Clc1cccc(Cl)c1NC1=NCCN1.
What is the InChIKey of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol?
The InChIKey is FMKPELCPHMBZEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2N3.C2H6O/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9;1-2-3/h1-3H,4-5H2,(H2,12,13,14);3H,2H2,1H3.
What are the key properties of N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol?
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol has a molecular weight of 276.17 g/mol, XLogP of 2.36, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;ethanol is sourced from PubChem (CID 122517146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).