C20H19N9O — CID 122517504
1-[2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile (PubChem CID 122517504) has the molecular formula C20H19N9O and a molecular weight of 401.43 g/mol. Its IUPAC name is 1-[2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile.
| Compound Name | 1-[2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 122517504 |
| Molecular Formula | C20H19N9O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC(C#N)C3)nc(-c3cnc4nc[nH]c4c3)nc12 |
| InChI | InChI=1S/C20H19N9O/c1-20(2)19-25-14-17(28-8-11(6-21)9-28)26-15(27-18(14)29(19)3-4-30-20)12-5-13-16(22-7-12)24-10-23-13/h5,7,10-11H,3-4,8-9H2,1-2H3,(H,22,23,24) |
| InChIKey | HLTQWQDRHUPNNC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |