C21H19ClN8O — CID 122517528
1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile (PubChem CID 122517528) has the molecular formula C21H19ClN8O and a molecular weight of 434.89 g/mol. Its IUPAC name is 1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile.
| Compound Name | 1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 122517528 |
| Molecular Formula | C21H19ClN8O |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidine-3-carbonitrile |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC(C#N)C3)nc(-c3cnc4[nH]cc(Cl)c4c3)nc12 |
| InChI | InChI=1S/C21H19ClN8O/c1-21(2)20-26-15-18(29-9-11(6-23)10-29)27-16(28-19(15)30(20)3-4-31-21)12-5-13-14(22)8-25-17(13)24-7-12/h5,7-8,11H,3-4,9-10H2,1-2H3,(H,24,25) |
| InChIKey | ICJLYKWYVLKPLY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |