C20H22N8O2 — CID 122517554
2-(1H-imidazo[4,5-b]pyridin-6-yl)-4-(3-methoxyazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122517554) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-6-yl)-4-(3-methoxyazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-6-yl)-4-(3-methoxyazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122517554 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-6-yl)-4-(3-methoxyazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | COC1CN(c2nc(-c3cnc4nc[nH]c4c3)nc3c2nc2n3CCOC2(C)C)C1 |
| InChI | InChI=1S/C20H22N8O2/c1-20(2)19-24-14-17(27-8-12(9-27)29-3)25-15(26-18(14)28(19)4-5-30-20)11-6-13-16(21-7-11)23-10-22-13/h6-7,10,12H,4-5,8-9H2,1-3H3,(H,21,22,23) |
| InChIKey | CYSWPTMQKZIUOA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |