C27H30N8O4 — CID 122517853
N-[3-[[2-(1-methylpiperidin-4-yl)oxy-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]-4-nitrobenzamide (PubChem CID 122517853) has the molecular formula C27H30N8O4 and a molecular weight of 530.59 g/mol. Its IUPAC name is N-[3-[[2-(1-methylpiperidin-4-yl)oxy-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[[2-(1-methylpiperidin-4-yl)oxy-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 122517853 |
| Molecular Formula | C27H30N8O4 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[3-[[2-(1-methylpiperidin-4-yl)oxy-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]phenyl]-4-nitrobenzamide |
| SMILES | CC(C)c1cnn2c(Nc3cccc(NC(=O)c4ccc([N+](=O)[O-])cc4)c3)nc(OC3CCN(C)CC3)nc12 |
| InChI | InChI=1S/C27H30N8O4/c1-17(2)23-16-28-34-24(23)31-27(39-22-11-13-33(3)14-12-22)32-26(34)30-20-6-4-5-19(15-20)29-25(36)18-7-9-21(10-8-18)35(37)38/h4-10,15-17,22H,11-14H2,1-3H3,(H,29,36)(H,30,31,32) |
| InChIKey | ZWAUAETULZNSTO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|