C23H32ClN9O — CID 122518646
(2R)-2-amino-2-[[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-ethylpyrimidin-4-yl]amino]methyl]-N-propan-2-ylpiperidine-1-carbohydrazide (PubChem CID 122518646) has the molecular formula C23H32ClN9O and a molecular weight of 486.02 g/mol. Its IUPAC name is (2R)-2-amino-2-[[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-ethylpyrimidin-4-yl]amino]methyl]-N-propan-2-ylpiperidine-1-carbohydrazide.
| Compound Name | (2R)-2-amino-2-[[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-ethylpyrimidin-4-yl]amino]methyl]-N-propan-2-ylpiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 122518646 |
| Molecular Formula | C23H32ClN9O |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | (2R)-2-amino-2-[[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-ethylpyrimidin-4-yl]amino]methyl]-N-propan-2-ylpiperidine-1-carbohydrazide |
| SMILES | CCc1cnc(-c2c[nH]c3ncc(Cl)cc23)nc1NC[C@@]1(N)CCCCN1C(=O)N(N)C(C)C |
| InChI | InChI=1S/C23H32ClN9O/c1-4-15-10-27-21(18-12-29-20-17(18)9-16(24)11-28-20)31-19(15)30-13-23(25)7-5-6-8-32(23)22(34)33(26)14(2)3/h9-12,14H,4-8,13,25-26H2,1-3H3,(H,28,29)(H,27,30,31)/t23-/m1/s1 |
| InChIKey | OIRSPKQVRSVIBN-HSZRJFAPSA-N |
| XLogP | 3.49 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|