About 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole
7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole (PubChem CID 122519712) has the molecular formula C20H15N3S
and a molecular weight of 329.43 g/mol. Its IUPAC name is 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole |
| PubChem CID | 122519712 |
| Molecular Formula | C20H15N3S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole |
| SMILES | Cc1ccc2c(c1)[nH]c1cc(-c3ccc(C)c4nsnc34)ccc12 |
| InChI | InChI=1S/C20H15N3S/c1-11-3-6-15-16-8-5-13(10-18(16)21-17(15)9-11)14-7-4-12(2)19-20(14)23-24-22-19/h3-10,21H,1-2H3 |
| InChIKey | IEMPBDQPMBFFOW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole?
The IUPAC name of 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole (CID 122519712) is 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole.
What is the SMILES notation for 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole?
The canonical SMILES for 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole is Cc1ccc2c(c1)[nH]c1cc(-c3ccc(C)c4nsnc34)ccc12.
What is the InChIKey of 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole?
The InChIKey is IEMPBDQPMBFFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3S/c1-11-3-6-15-16-8-5-13(10-18(16)21-17(15)9-11)14-7-4-12(2)19-20(14)23-24-22-19/h3-10,21H,1-2H3.
What are the key properties of 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole?
7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole has a molecular weight of 329.43 g/mol, XLogP of 5.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-(7-methyl-9H-carbazol-2-yl)-2,1,3-benzothiadiazole is sourced from PubChem (CID 122519712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).