C15H29N3 — CID 122519804
2,2,3,3,7,7,8,8-octamethyl-6,9-dihydro-4H-pyrimido[1,2-a]pyrimidine (PubChem CID 122519804) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 2,2,3,3,7,7,8,8-octamethyl-6,9-dihydro-4H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 2,2,3,3,7,7,8,8-octamethyl-6,9-dihydro-4H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 122519804 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 2,2,3,3,7,7,8,8-octamethyl-6,9-dihydro-4H-pyrimido[1,2-a]pyrimidine |
| SMILES | CC1(C)CN2CC(C)(C)C(C)(C)NC2=NC1(C)C |
| InChI | InChI=1S/C15H29N3/c1-12(2)9-18-10-13(3,4)15(7,8)17-11(18)16-14(12,5)6/h9-10H2,1-8H3,(H,16,17) |
| InChIKey | SBAABRPKFTUWFA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |