C22H30Cl2N6O3 — CID 122520220
tert-butyl N-[4-[[2-[(3,4-dichlorophenyl)carbamoylamino]-6-methylpyrimidin-4-yl]amino]butyl]-N-methylcarbamate (PubChem CID 122520220) has the molecular formula C22H30Cl2N6O3 and a molecular weight of 497.43 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[(3,4-dichlorophenyl)carbamoylamino]-6-methylpyrimidin-4-yl]amino]butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[[2-[(3,4-dichlorophenyl)carbamoylamino]-6-methylpyrimidin-4-yl]amino]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 122520220 |
| Molecular Formula | C22H30Cl2N6O3 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | tert-butyl N-[4-[[2-[(3,4-dichlorophenyl)carbamoylamino]-6-methylpyrimidin-4-yl]amino]butyl]-N-methylcarbamate |
| SMILES | Cc1cc(NCCCCN(C)C(=O)OC(C)(C)C)nc(NC(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C22H30Cl2N6O3/c1-14-12-18(25-10-6-7-11-30(5)21(32)33-22(2,3)4)28-19(26-14)29-20(31)27-15-8-9-16(23)17(24)13-15/h8-9,12-13H,6-7,10-11H2,1-5H3,(H3,25,26,27,28,29,31) |
| InChIKey | SWSYYVNKTNZEQL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|